-
![C30H29FN2O7 Uridin, 5'-O- [Bis (4-Methoxyphenyl) phenylmethyl] -2'-deoxy-2'-fluor- (9ci, aci)](https://cdn.globalso.com/nvchem/C30H29FN2O7-Uridine.jpg)
C30H29FN2O7 Uridin, 5'-O- [Bis (4-Methoxyphenyl) phenylmethyl] -2'-deoxy-2'-fluor- (9ci, aci)
Physikalische Eigenschaften wichtige physikalische Eigenschaften Wert Bedingung Molekulargewicht 548,56 - Schmelzpunkt (experimentell) 118-120 ° C - Dichte (vorhergesagt) 1,38 ± 0,1 g/cm3 Temp: 20 ° C; Drücken Sie: 760 Torr PKA (vorhergesagt) 9,39 ± 0,10 Die saure Temperatur: 25 ° C Andere Namen und Kennungen kanonischer Lächeln o = c1c = cn (c (= o) n1) c2oc (cc = 3c = cc = cc3) (c4 = c (Oc) c (Oc) c (Oc) c (Oc) C (Oc) C (Ocf) C (Ocf) C (Ocf) C (Ocf) C (Ocf) c (Oc) C (Ocf) C (Ocf) C (Ocf) C (Ocf) C (Ocf) C (OC) c (Oc) c (OCF) c (OCF) C (OC) C (OCF) C (OC) C (OC) C (OC) c (OCF) c (OC) C (OC) C (OCF) C (OC) C (OC) c (OC) c (OC) c (OC) c (OCF) C (OC) C (OC) C5 = C. Isomerisches Lächeln c (oc [c@h] 1o [c@h] ([c@h] (f) [c @@ h] 1o) n2c (= o) nc (= o) c = c2) (c3 = cc = c (oc) c = c3) (c4 = cc = c (oc) c = c4) c5 = cc = cc = cc = cc = cc = cc = cc = cc = cc = c5 ... -
![C31H30N2O7 6H-FURO [2 ', 3': 4,5] Oxazolo [3,2-A] Pyrimidin-6-One, 2-[Bis (4-Methoxy Phenyl) Phenylmethoxy] -Methyl] -2,3a, 9a-Tetrahydro-3-Hydro-3-Hydro-3-Hydro-3-Hydro-3-Hydro-3-Hydro-3-Hydroxy-7-methyl-7-methyl-7-methyl-7-methyl-, methyl-7-methyl-, methyl-7-methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl- ( (2r, 3r, 3as, 9ar)- (9CI, ACI)](https://cdn.globalso.com/nvchem/C31H30N2O7-6H-Furo.jpg)
C31H30N2O7 6H-FURO [2 ', 3': 4,5] Oxazolo [3,2-A] Pyrimidin-6-One, 2-[Bis (4-Methoxy Phenyl) Phenylmethoxy] -Methyl] -2,3a, 9a-Tetrahydro-3-Hydro-3-Hydro-3-Hydro-3-Hydro-3-Hydro-3-Hydro-3-Hydroxy-7-methyl-7-methyl-7-methyl-7-methyl-, methyl-7-methyl-, methyl-7-methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl-, methyl- ( (2r, 3r, 3as, 9ar)- (9CI, ACI)
Physikalische Eigenschaften wichtige physikalische Eigenschaften Wert Bedingung Molekulargewicht 542,58 - Siedepunkt (vorhergesagt) 692,9 ± 65,0 ° C Drücken Sie: 760 Torr -Dichte (vorhergesagt) 1,33 ± 0,1 g/cm3 Temp: 20 ° C; Press: 760 Torr pKa (Predicted) 12.51±0.60 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1N=C2OC3C(O)C(OC3N2C=C1C)COC(C=4C=CC=CC4)(C5=CC=C(OC)C=C5)C6=CC=C(OC)C=C6 Isomeric Smiles C (oc [c@h] 1o [c @@] 2 ([c@] ([c @@ h] 1o) (oc = 3n2c = c (c) c (= o) n3) [h]) [h]) (c4 = cc = c (oc) c = c4) (c5 = cc ... -
C33H35N3O8 Cytidin, N-Acetyl-5'-O-[Bis (4-Methoxyphenyl) phenylmethyls-2'-O-Methyl- (9CI, ACI)
Physikalische Eigenschaften wichtige physikalische Eigenschaften Wert Bedingung Molekulargewicht 601,65 - Dichte (vorhergesagt) 1,28 ± 0,1 g/cm3 Temp: 20 ° C; Presse: 760 Torr PKA (vorhergesagt) 10,19 ± 0,20 Säurigste Temperatur: 25 ° C Andere Namen und Kennzeichen kanonisches Lächeln O = c1n = c (c = cn1c2oc (coc (c = 3c = cc = cc3) (c4 = cc = c (oc) c = c4) c5 = cc = c (oc) c = c5) c (o) c2oc) nc (= o) c isomeres Lächeln C (oc [c@h] 1o [c@h] ([c@h] (oc) [c @@ h] 1o) n2c (= o) n = c (nc (c) = o) c = c2) (c3 = cc = c (oc) c = c3) (c4 = cc = c (oc) c = c = c5 = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = c5 inch Inchi = 1S/C33H35N3O8/C1-2 ... -
![C31H32N2O8 Uridin, 5'-o- [Bis (4-methoxyphenyl) phenylmethyl] -2'-o-methyl- (9c i, aci)](https://cdn.globalso.com/nvchem/C31H32N2O8-Uridine.jpg)
C31H32N2O8 Uridin, 5'-o- [Bis (4-methoxyphenyl) phenylmethyl] -2'-o-methyl- (9c i, aci)
Physikalische Eigenschaften wichtige physikalische Eigenschaften Wert Zustand Molekulargewicht 560,60 - Dichte (vorhergesagt) 1,35 ± 0,1 g/cm3 Temp: 20 ° C; Press: 760 Torr pKa (Predicted) 9.39±0.10 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES O=C1C=CN(C(=O)N1)C2OC(COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)C(O)C2OC Isomerisches Lächeln c (oc [c@h] 1o [c@h] ([c@h] (oc) [c @@ h] 1o) n2c (= o) nc (= o) c = c2) (c3 = cc = c (oc) c = c3) (c4 = cc = c (oc) c = c4) c5 = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = cc = c5 Inch Inchi = 1S/C31H32N2O8/C1-37-23-13-9-2 ... -
![C30H28N2O7 6H-Furo[2′,3′:4,5]oxazolo[3,2-a]pyrimidin-6-one, 2-[[bis(4-methoxy phenyl)phenylmethoxy]methyl]-2,3,3a,9a-tetrahydro-3-hydroxy-, (2R,3R,3aS,9aR)- (9CI, ACI)](https://cdn.globalso.com/nvchem/C30H28N2O7-6H-Furo.jpg)
C30H28N2O7 6H-Furo[2′,3′:4,5]oxazolo[3,2-a]pyrimidin-6-one, 2-[[bis(4-methoxy phenyl)phenylmethoxy]methyl]-2,3,3a,9a-tetrahydro-3-hydroxy-, (2R,3R,3aS,9aR)- (9CI, ACI)
Physikalische Eigenschaften Key Physikalische Eigenschaften Wert Bedingung Molekulargewicht 528,55 - Schmelzpunkt (experimentell) 129,5-130 ° C - Siedepunkt (vorhergesagt) 688,2 ± 65,0 ° C Drücken Sie: 760 Torr -Dichte (vorhergesagt) 1,35 ± 0,1 g/cm3 Temp: 20 ° C; Drücken Sie: 760 Torr PKA (vorhergesagt) 12,51 ± 0,40 Säurigste Temperatur: 25 ° C Andere Namen und Identifikatoren kanonischer Lächeln O = C1N = C2OC3C (O) C (OC3N2C = C1) COC (C = 4C = CC4) (OC) C (OC) C (OC) C (OC) C (OC) C (OC) C (OC) C (OC) C (OC) C (OC) C (OC) C (OC) C (OC) C (OC) C. C5) C. C (oc [c@h] 1o [c @@] 2 ([c@] ([c @@ h] 1o) (oc = 3n2 ... -
![C36H39N5O8 Guanosin, 5'-O- [Bis (4-Methoxyphenyl) phenylmethyl] -2'-o-methyl-n- (2-methyl-1-oxopropyl)-(9Ci, ACI)](https://cdn.globalso.com/nvchem/C36H39N5O8-Guanosine.jpg)
C36H39N5O8 Guanosin, 5'-O- [Bis (4-Methoxyphenyl) phenylmethyl] -2'-o-methyl-n- (2-methyl-1-oxopropyl)-(9Ci, ACI)
Physikalische Eigenschaften wichtige physikalische Eigenschaften Wert Bedingung Molekulargewicht 669,72 - Dichte (vorhergesagt) 1,35 ± 0,1 g/cm3 Temp: 20 ° C; Presse: 760 Torr PKA (vorhergesagt) 9,16 ± 0,20 Säurigste Temperatur: 25 ° C Andere Namen und Kennzeichen kanonisches Lächeln O = c1n = c (nc (= o) c (c) c) nc2 = c1n = cn2c3oc (cc = 4c = cc = cc4) (c5 = cc = c (oc) c = c5) c6 = cc = c (oc) c = C6) C (O) c3oc -isomer Smiles C (oc [c@h] 1o [c@h] ([c@h] (oc) [c @@ h] 1o) n2c3 = c (n = c2) c (= o) n = c (nc (c) c (c) c (c) c (c) cc = cc = cc = c (cc = cc = cc = cc = cc = cc = cc = cc = cc = c). -
C15H21N5O6 Guanosin, 2'-o-methyl-n- (2-methyl-1-oxopropyl)-(9ci, aci)
Physikalische Eigenschaften wichtige physikalische Eigenschaften Wert Bedingung Molekulargewicht 367,36 - Dichte (vorhergesagt) 1,68 ± 0,1 g/cm3 Temp: 20 ° C; Drücken Sie: 760 Torr PKA (vorhergesagt) 9,16 ± 0,20 Die meisten sauren Temperaturen: 25 ° C Andere Namen und Kennungen kanonischer Lächeln o = c1n = c (nc (= o) c (c) c) C3oc -Smiles nc2 = c1n = cn2c3oc (co) c (O) c (O) c3oc isomer Smiles -Smiles isomer Smiles -Smiles isomer Smiles. O (c) [c@h] 1 [c@h] (n2c3 = c (n = c2) c (= o) n = c (nc (c (c) c) = o) n3) o [c@h] (co) [c@h] 1o inchi Inchi = 1S/C15H21N5O6/C1-6 (2) 12 (23) 18-15-17-11-8 (13 (24) 19-15) 16-5-20 (11) 14-10 (25-3) 9 (22) 7 (4-21) 26 -... -
![C39H37N5O7 Adenosin, N-Benzoyl-5'-O- [Bis (4-methoxyphenyl) phenylmethyl] -2'-o-methyl- (9ci, aci)](https://cdn.globalso.com/nvchem/Substance-Detail.jpg)
C39H37N5O7 Adenosin, N-Benzoyl-5'-O- [Bis (4-methoxyphenyl) phenylmethyl] -2'-o-methyl- (9ci, aci)
Physikalische Eigenschaften wichtige physikalische Eigenschaften Wert Bedingung Molekulargewicht 687,74 - Dichte (vorhergesagt) 1,32 ± 0,1 g/cm3 Temp: 20 ° C; Drücken Sie: 760 Torr PKA (vorhergesagt) 7,87 ± 0,43 Säurigste Temperatur: 25 ° C andere Namen und Kennzeichen Kanonisches Lächeln O = c (nc1 = nc = nc2 = c1n = cn2c3oc (coc (c = 4c = cc = cc4) (c5 = cc = c (oc) c = c5) c6 = cc = c (oc) c = c6) c (o) c3oc) c = 7c = cc = cc = cc7 isomer Smiles C (oc [c@h] 1o [c@h] ([c@h] (oc) [c @@ h] 1o) n2c = 3c (n = c2) = c (nc (= o) c4 = cc = cc = c4) n = cn3) (c5 = cc = c (cc = c5) C5 = C.
